C25H32F3N5OS — CID 170950826
2,2-difluoro-3-[(1S,3R)-1-[2-[[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]amino]-1,3-thiazol-5-yl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]propan-1-ol (PubChem CID 170950826) has the molecular formula C25H32F3N5OS and a molecular weight of 507.63 g/mol. Its IUPAC name is 2,2-difluoro-3-[(1S,3R)-1-[2-[[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]amino]-1,3-thiazol-5-yl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]propan-1-ol.
| Compound Name | 2,2-difluoro-3-[(1S,3R)-1-[2-[[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]amino]-1,3-thiazol-5-yl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 170950826 |
| Molecular Formula | C25H32F3N5OS |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | 2,2-difluoro-3-[(1S,3R)-1-[2-[[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]amino]-1,3-thiazol-5-yl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]propan-1-ol |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2cnc(N[C@H]3CCN(CCCF)C3)s2)N1CC(F)(F)CO |
| InChI | InChI=1S/C25H32F3N5OS/c1-16-11-19-18-5-2-3-6-20(18)31-22(19)23(33(16)14-25(27,28)15-34)21-12-29-24(35-21)30-17-7-10-32(13-17)9-4-8-26/h2-3,5-6,12,16-17,23,31,34H,4,7-11,13-15H2,1H3,(H,29,30)/t16-,17+,23-/m1/s1 |
| InChIKey | GXRPTJVDIUOBLK-SAHWJRBASA-N |
| XLogP | 4.43 |
| TPSA | 67.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|