C29H34F5N3O — CID 145418254
3-[(1R)-1-[2,6-difluoro-4-[1-[1-(3-fluoropropyl)azetidin-3-yl]ethyl]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-difluoropropan-1-ol (PubChem CID 145418254) has the molecular formula C29H34F5N3O and a molecular weight of 535.60 g/mol. Its IUPAC name is 3-[(1R)-1-[2,6-difluoro-4-[1-[1-(3-fluoropropyl)azetidin-3-yl]ethyl]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-difluoropropan-1-ol.
| Compound Name | 3-[(1R)-1-[2,6-difluoro-4-[1-[1-(3-fluoropropyl)azetidin-3-yl]ethyl]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-difluoropropan-1-ol |
|---|---|
| PubChem CID | 145418254 |
| Molecular Formula | C29H34F5N3O |
| Molecular Weight | 535.60 g/mol |
| Exact Mass | 535.26 |
| IUPAC Name | 3-[(1R)-1-[2,6-difluoro-4-[1-[1-(3-fluoropropyl)azetidin-3-yl]ethyl]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-difluoropropan-1-ol |
| SMILES | CC(c1cc(F)c([C@@H]2c3[nH]c4ccccc4c3CC(C)N2CC(F)(F)CO)c(F)c1)C1CN(CCCF)C1 |
| InChI | InChI=1S/C29H34F5N3O/c1-17-10-22-21-6-3-4-7-25(21)35-27(22)28(37(17)15-29(33,34)16-38)26-23(31)11-19(12-24(26)32)18(2)20-13-36(14-20)9-5-8-30/h3-4,6-7,11-12,17-18,20,28,35,38H,5,8-10,13-16H2,1-2H3/t17?,18?,28-/m1/s1 |
| InChIKey | DOOSHOBBBXPZGN-WOLMIXIISA-N |
| XLogP | 5.80 |
| TPSA | 42.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.60 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|