C27H32F4N4O — CID 153378692
3-[(1R,3R)-1-[2,6-difluoro-4-[[1-(3-fluoropropyl)azetidin-3-yl]amino]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-fluoropropan-1-ol (PubChem CID 153378692) has the molecular formula C27H32F4N4O and a molecular weight of 504.57 g/mol. Its IUPAC name is 3-[(1R,3R)-1-[2,6-difluoro-4-[[1-(3-fluoropropyl)azetidin-3-yl]amino]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-fluoropropan-1-ol.
| Compound Name | 3-[(1R,3R)-1-[2,6-difluoro-4-[[1-(3-fluoropropyl)azetidin-3-yl]amino]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-fluoropropan-1-ol |
|---|---|
| PubChem CID | 153378692 |
| Molecular Formula | C27H32F4N4O |
| Molecular Weight | 504.57 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | 3-[(1R,3R)-1-[2,6-difluoro-4-[[1-(3-fluoropropyl)azetidin-3-yl]amino]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-fluoropropan-1-ol |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2c(F)cc(NC3CN(CCCF)C3)cc2F)N1CC(F)CO |
| InChI | InChI=1S/C27H32F4N4O/c1-16-9-21-20-5-2-3-6-24(20)33-26(21)27(35(16)12-17(29)15-36)25-22(30)10-18(11-23(25)31)32-19-13-34(14-19)8-4-7-28/h2-3,5-6,10-11,16-17,19,27,32-33,36H,4,7-9,12-15H2,1H3/t16-,17?,27-/m1/s1 |
| InChIKey | LWMUGMZINQGJQS-BPGLNSGHSA-N |
| XLogP | 4.57 |
| TPSA | 54.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.57 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|