C29H35F3N4O — CID 167072900
4-[(1S,3S)-1-[2,6-difluoro-4-[[1-(3-fluoropropyl)azetidin-3-yl]amino]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-methylidenebutan-1-ol (PubChem CID 167072900) has the molecular formula C29H35F3N4O and a molecular weight of 512.62 g/mol. Its IUPAC name is 4-[(1S,3S)-1-[2,6-difluoro-4-[[1-(3-fluoropropyl)azetidin-3-yl]amino]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-methylidenebutan-1-ol.
| Compound Name | 4-[(1S,3S)-1-[2,6-difluoro-4-[[1-(3-fluoropropyl)azetidin-3-yl]amino]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-methylidenebutan-1-ol |
|---|---|
| PubChem CID | 167072900 |
| Molecular Formula | C29H35F3N4O |
| Molecular Weight | 512.62 g/mol |
| Exact Mass | 512.28 |
| IUPAC Name | 4-[(1S,3S)-1-[2,6-difluoro-4-[[1-(3-fluoropropyl)azetidin-3-yl]amino]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-methylidenebutan-1-ol |
| SMILES | C=C(CO)CCN1[C@@H](c2c(F)cc(NC3CN(CCCF)C3)cc2F)c2[nH]c3ccccc3c2C[C@@H]1C |
| InChI | InChI=1S/C29H35F3N4O/c1-18(17-37)8-11-36-19(2)12-23-22-6-3-4-7-26(22)34-28(23)29(36)27-24(31)13-20(14-25(27)32)33-21-15-35(16-21)10-5-9-30/h3-4,6-7,13-14,19,21,29,33-34,37H,1,5,8-12,15-17H2,2H3/t19-,29-/m0/s1 |
| InChIKey | ZBMQTKLWMYOPOR-SLQAJWMNSA-N |
| XLogP | 5.18 |
| TPSA | 54.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.62 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|