C27H31F5N4O — CID 166847914
N-[4-[(1R)-2-(2,2-difluoro-2-methoxyethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]-1-(3-fluoropropyl)azetidin-3-amine (PubChem CID 166847914) has the molecular formula C27H31F5N4O and a molecular weight of 522.56 g/mol. Its IUPAC name is N-[4-[(1R)-2-(2,2-difluoro-2-methoxyethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]-1-(3-fluoropropyl)azetidin-3-amine.
| Compound Name | N-[4-[(1R)-2-(2,2-difluoro-2-methoxyethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]-1-(3-fluoropropyl)azetidin-3-amine |
|---|---|
| PubChem CID | 166847914 |
| Molecular Formula | C27H31F5N4O |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.24 |
| IUPAC Name | N-[4-[(1R)-2-(2,2-difluoro-2-methoxyethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]-1-(3-fluoropropyl)azetidin-3-amine |
| SMILES | COC(F)(F)CN1C(C)Cc2c([nH]c3ccccc23)[C@H]1c1c(F)cc(NC2CN(CCCF)C2)cc1F |
| InChI | InChI=1S/C27H31F5N4O/c1-16-10-20-19-6-3-4-7-23(19)34-25(20)26(36(16)15-27(31,32)37-2)24-21(29)11-17(12-22(24)30)33-18-13-35(14-18)9-5-8-28/h3-4,6-7,11-12,16,18,26,33-34H,5,8-10,13-15H2,1-2H3/t16?,26-/m1/s1 |
| InChIKey | CHBZJDDMMGTSEZ-IIVOFZELSA-N |
| XLogP | 5.48 |
| TPSA | 43.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|