C26H27F6IN4 — CID 166473235
N-[3,5-difluoro-4-[(1R,3R)-7-iodo-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-1-(3-fluoropropyl)azetidin-3-amine (PubChem CID 166473235) has the molecular formula C26H27F6IN4 and a molecular weight of 636.42 g/mol. Its IUPAC name is N-[3,5-difluoro-4-[(1R,3R)-7-iodo-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-1-(3-fluoropropyl)azetidin-3-amine.
| Compound Name | N-[3,5-difluoro-4-[(1R,3R)-7-iodo-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-1-(3-fluoropropyl)azetidin-3-amine |
|---|---|
| PubChem CID | 166473235 |
| Molecular Formula | C26H27F6IN4 |
| Molecular Weight | 636.42 g/mol |
| Exact Mass | 636.12 |
| IUPAC Name | N-[3,5-difluoro-4-[(1R,3R)-7-iodo-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-1-(3-fluoropropyl)azetidin-3-amine |
| SMILES | C[C@@H]1Cc2c([nH]c3cc(I)ccc23)[C@@H](c2c(F)cc(NC3CN(CCCF)C3)cc2F)N1CC(F)(F)F |
| InChI | InChI=1S/C26H27F6IN4/c1-14-7-19-18-4-3-15(33)8-22(18)35-24(19)25(37(14)13-26(30,31)32)23-20(28)9-16(10-21(23)29)34-17-11-36(12-17)6-2-5-27/h3-4,8-10,14,17,25,34-35H,2,5-7,11-13H2,1H3/t14-,25-/m1/s1 |
| InChIKey | WPNAFEUQDXQQCT-DLUDVSRJSA-N |
| XLogP | 6.40 |
| TPSA | 34.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.42 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|