C26H28F6N4O — CID 156894836
(1R,3R)-1-[2,6-difluoro-4-[[1-(3-fluoropropyl)azetidin-3-yl]amino]phenyl]-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-6-ol (PubChem CID 156894836) has the molecular formula C26H28F6N4O and a molecular weight of 526.53 g/mol. Its IUPAC name is (1R,3R)-1-[2,6-difluoro-4-[[1-(3-fluoropropyl)azetidin-3-yl]amino]phenyl]-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-6-ol.
| Compound Name | (1R,3R)-1-[2,6-difluoro-4-[[1-(3-fluoropropyl)azetidin-3-yl]amino]phenyl]-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-6-ol |
|---|---|
| PubChem CID | 156894836 |
| Molecular Formula | C26H28F6N4O |
| Molecular Weight | 526.53 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | (1R,3R)-1-[2,6-difluoro-4-[[1-(3-fluoropropyl)azetidin-3-yl]amino]phenyl]-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-6-ol |
| SMILES | C[C@@H]1Cc2c([nH]c3ccc(O)cc23)[C@@H](c2c(F)cc(NC3CN(CCCF)C3)cc2F)N1CC(F)(F)F |
| InChI | InChI=1S/C26H28F6N4O/c1-14-7-19-18-10-17(37)3-4-22(18)34-24(19)25(36(14)13-26(30,31)32)23-20(28)8-15(9-21(23)29)33-16-11-35(12-16)6-2-5-27/h3-4,8-10,14,16,25,33-34,37H,2,5-7,11-13H2,1H3/t14-,25-/m1/s1 |
| InChIKey | FPOVJBORZPDFJB-DLUDVSRJSA-N |
| XLogP | 5.51 |
| TPSA | 54.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.53 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|