C27H30F6N4 — CID 166849370
(3S)-N-[3,5-difluoro-4-[(1R,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-1-(3-fluoropropyl)pyrrolidin-3-amine (PubChem CID 166849370) has the molecular formula C27H30F6N4 and a molecular weight of 524.55 g/mol. Its IUPAC name is (3S)-N-[3,5-difluoro-4-[(1R,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-1-(3-fluoropropyl)pyrrolidin-3-amine.
| Compound Name | (3S)-N-[3,5-difluoro-4-[(1R,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-1-(3-fluoropropyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 166849370 |
| Molecular Formula | C27H30F6N4 |
| Molecular Weight | 524.55 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | (3S)-N-[3,5-difluoro-4-[(1R,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-1-(3-fluoropropyl)pyrrolidin-3-amine |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2c(F)cc(N[C@H]3CCN(CCCF)C3)cc2F)N1CC(F)(F)F |
| InChI | InChI=1S/C27H30F6N4/c1-16-11-20-19-5-2-3-6-23(19)35-25(20)26(37(16)15-27(31,32)33)24-21(29)12-18(13-22(24)30)34-17-7-10-36(14-17)9-4-8-28/h2-3,5-6,12-13,16-17,26,34-35H,4,7-11,14-15H2,1H3/t16-,17+,26-/m1/s1 |
| InChIKey | HHOPFZCXWJZNIA-KRXBEKAOSA-N |
| XLogP | 6.19 |
| TPSA | 34.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.55 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|