C31H37F3N4O — CID 164561431
[3-[(1R,3R)-1-[2,6-difluoro-4-[[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]amino]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-1-bicyclo[1.1.1]pentanyl]methanol (PubChem CID 164561431) has the molecular formula C31H37F3N4O and a molecular weight of 538.66 g/mol. Its IUPAC name is [3-[(1R,3R)-1-[2,6-difluoro-4-[[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]amino]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-1-bicyclo[1.1.1]pentanyl]methanol.
| Compound Name | [3-[(1R,3R)-1-[2,6-difluoro-4-[[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]amino]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-1-bicyclo[1.1.1]pentanyl]methanol |
|---|---|
| PubChem CID | 164561431 |
| Molecular Formula | C31H37F3N4O |
| Molecular Weight | 538.66 g/mol |
| Exact Mass | 538.29 |
| IUPAC Name | [3-[(1R,3R)-1-[2,6-difluoro-4-[[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]amino]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-1-bicyclo[1.1.1]pentanyl]methanol |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2c(F)cc(N[C@H]3CCN(CCCF)C3)cc2F)N1C12CC(CO)(C1)C2 |
| InChI | InChI=1S/C31H37F3N4O/c1-19-11-23-22-5-2-3-6-26(22)36-28(23)29(38(19)31-15-30(16-31,17-31)18-39)27-24(33)12-21(13-25(27)34)35-20-7-10-37(14-20)9-4-8-32/h2-3,5-6,12-13,19-20,29,35-36,39H,4,7-11,14-18H2,1H3/t19-,20+,29-,30?,31?/m1/s1 |
| InChIKey | WCQVAHMFQFUZFL-JXVXKCJKSA-N |
| XLogP | 5.54 |
| TPSA | 54.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.66 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|