C30H37FN4 — CID 164775225
N-[4-[(1R,3R)-2-(1-bicyclo[1.1.1]pentanyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-1-(3-fluoropropyl)pyrrolidin-3-amine (PubChem CID 164775225) has the molecular formula C30H37FN4 and a molecular weight of 472.65 g/mol. Its IUPAC name is N-[4-[(1R,3R)-2-(1-bicyclo[1.1.1]pentanyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-1-(3-fluoropropyl)pyrrolidin-3-amine.
| Compound Name | N-[4-[(1R,3R)-2-(1-bicyclo[1.1.1]pentanyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-1-(3-fluoropropyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 164775225 |
| Molecular Formula | C30H37FN4 |
| Molecular Weight | 472.65 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | N-[4-[(1R,3R)-2-(1-bicyclo[1.1.1]pentanyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-1-(3-fluoropropyl)pyrrolidin-3-amine |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2ccc(NC3CCN(CCCF)C3)cc2)N1C12CC(C1)C2 |
| InChI | InChI=1S/C30H37FN4/c1-20-15-26-25-5-2-3-6-27(25)33-28(26)29(35(20)30-16-21(17-30)18-30)22-7-9-23(10-8-22)32-24-11-14-34(19-24)13-4-12-31/h2-3,5-10,20-21,24,29,32-33H,4,11-19H2,1H3/t20-,21?,24?,29-,30?/m1/s1 |
| InChIKey | AXMCTAMLXLCGNM-JIPMXBMESA-N |
| XLogP | 5.90 |
| TPSA | 34.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.65 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|