C28H33F5N4O — CID 167203222
(3S)-N-[4-[(1R,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3-(difluoromethoxy)phenyl]-1-(3-fluoropropyl)pyrrolidin-3-amine (PubChem CID 167203222) has the molecular formula C28H33F5N4O and a molecular weight of 536.59 g/mol. Its IUPAC name is (3S)-N-[4-[(1R,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3-(difluoromethoxy)phenyl]-1-(3-fluoropropyl)pyrrolidin-3-amine.
| Compound Name | (3S)-N-[4-[(1R,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3-(difluoromethoxy)phenyl]-1-(3-fluoropropyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 167203222 |
| Molecular Formula | C28H33F5N4O |
| Molecular Weight | 536.59 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | (3S)-N-[4-[(1R,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3-(difluoromethoxy)phenyl]-1-(3-fluoropropyl)pyrrolidin-3-amine |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2ccc(N[C@H]3CCN(CCCF)C3)cc2OC(F)F)N1CC(F)F |
| InChI | InChI=1S/C28H33F5N4O/c1-17-13-22-20-5-2-3-6-23(20)35-26(22)27(37(17)16-25(30)31)21-8-7-18(14-24(21)38-28(32)33)34-19-9-12-36(15-19)11-4-10-29/h2-3,5-8,14,17,19,25,27-28,34-35H,4,9-13,15-16H2,1H3/t17-,19+,27-/m1/s1 |
| InChIKey | XDQQFWMUSAJULG-QMALHXIISA-N |
| XLogP | 6.22 |
| TPSA | 43.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.59 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|