C25H30F3N3OS — CID 170950777
(1S,3R)-2-(2,2-difluoroethyl)-1-[5-[(3R)-1-(3-fluoropropyl)pyrrolidin-3-yl]oxythiophen-2-yl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 170950777) has the molecular formula C25H30F3N3OS and a molecular weight of 477.60 g/mol. Its IUPAC name is (1S,3R)-2-(2,2-difluoroethyl)-1-[5-[(3R)-1-(3-fluoropropyl)pyrrolidin-3-yl]oxythiophen-2-yl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1S,3R)-2-(2,2-difluoroethyl)-1-[5-[(3R)-1-(3-fluoropropyl)pyrrolidin-3-yl]oxythiophen-2-yl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 170950777 |
| Molecular Formula | C25H30F3N3OS |
| Molecular Weight | 477.60 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | (1S,3R)-2-(2,2-difluoroethyl)-1-[5-[(3R)-1-(3-fluoropropyl)pyrrolidin-3-yl]oxythiophen-2-yl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2ccc(O[C@@H]3CCN(CCCF)C3)s2)N1CC(F)F |
| InChI | InChI=1S/C25H30F3N3OS/c1-16-13-19-18-5-2-3-6-20(18)29-24(19)25(31(16)15-22(27)28)21-7-8-23(33-21)32-17-9-12-30(14-17)11-4-10-26/h2-3,5-8,16-17,22,25,29H,4,9-15H2,1H3/t16-,17-,25-/m1/s1 |
| InChIKey | UROBERSLLIVJOB-RYUVBPIJSA-N |
| XLogP | 5.64 |
| TPSA | 31.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.60 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|