C30H33F3N4O — CID 167072701
4-[(1R,3R)-1-[2,6-difluoro-4-[(3R)-1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]pent-4-enenitrile (PubChem CID 167072701) has the molecular formula C30H33F3N4O and a molecular weight of 522.62 g/mol. Its IUPAC name is 4-[(1R,3R)-1-[2,6-difluoro-4-[(3R)-1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]pent-4-enenitrile.
| Compound Name | 4-[(1R,3R)-1-[2,6-difluoro-4-[(3R)-1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]pent-4-enenitrile |
|---|---|
| PubChem CID | 167072701 |
| Molecular Formula | C30H33F3N4O |
| Molecular Weight | 522.62 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | 4-[(1R,3R)-1-[2,6-difluoro-4-[(3R)-1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]pent-4-enenitrile |
| SMILES | C=C(CCC#N)N1[C@H](c2c(F)cc(O[C@@H]3CCN(CCCF)C3)cc2F)c2[nH]c3ccccc3c2C[C@H]1C |
| InChI | InChI=1S/C30H33F3N4O/c1-19(7-5-12-34)37-20(2)15-24-23-8-3-4-9-27(23)35-29(24)30(37)28-25(32)16-22(17-26(28)33)38-21-10-14-36(18-21)13-6-11-31/h3-4,8-9,16-17,20-21,30,35H,1,5-7,10-11,13-15,18H2,2H3/t20-,21-,30-/m1/s1 |
| InChIKey | DOMUBYDKVCZXQR-URCPOSBSSA-N |
| XLogP | 6.41 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.62 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|