C32H36F2N4O — CID 164775231
3-[(1R,3R)-1-[4-[(3R)-1-butylpyrrolidin-3-yl]oxy-2,6-difluorophenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]bicyclo[1.1.1]pentane-1-carbonitrile (PubChem CID 164775231) has the molecular formula C32H36F2N4O and a molecular weight of 530.66 g/mol. Its IUPAC name is 3-[(1R,3R)-1-[4-[(3R)-1-butylpyrrolidin-3-yl]oxy-2,6-difluorophenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]bicyclo[1.1.1]pentane-1-carbonitrile.
| Compound Name | 3-[(1R,3R)-1-[4-[(3R)-1-butylpyrrolidin-3-yl]oxy-2,6-difluorophenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]bicyclo[1.1.1]pentane-1-carbonitrile |
|---|---|
| PubChem CID | 164775231 |
| Molecular Formula | C32H36F2N4O |
| Molecular Weight | 530.66 g/mol |
| Exact Mass | 530.29 |
| IUPAC Name | 3-[(1R,3R)-1-[4-[(3R)-1-butylpyrrolidin-3-yl]oxy-2,6-difluorophenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]bicyclo[1.1.1]pentane-1-carbonitrile |
| SMILES | CCCCN1CC[C@@H](Oc2cc(F)c([C@@H]3c4[nH]c5ccccc5c4C[C@@H](C)N3C34CC(C#N)(C3)C4)c(F)c2)C1 |
| InChI | InChI=1S/C32H36F2N4O/c1-3-4-10-37-11-9-21(15-37)39-22-13-25(33)28(26(34)14-22)30-29-24(23-7-5-6-8-27(23)36-29)12-20(2)38(30)32-16-31(17-32,18-32)19-35/h5-8,13-14,20-21,30,36H,3-4,9-12,15-18H2,1-2H3/t20-,21-,30-,31?,32?/m1/s1 |
| InChIKey | IKCKCFWHJGPNNS-FDKDGKFJSA-N |
| XLogP | 6.48 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.66 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|