C30H37F2N3O2 — CID 162252018
(1R,3R)-1-[4-(1-butylazetidin-3-yl)oxy-2,6-difluorophenyl]-3-methyl-2-[(3-methyloxetan-3-yl)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 162252018) has the molecular formula C30H37F2N3O2 and a molecular weight of 509.64 g/mol. Its IUPAC name is (1R,3R)-1-[4-(1-butylazetidin-3-yl)oxy-2,6-difluorophenyl]-3-methyl-2-[(3-methyloxetan-3-yl)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1R,3R)-1-[4-(1-butylazetidin-3-yl)oxy-2,6-difluorophenyl]-3-methyl-2-[(3-methyloxetan-3-yl)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 162252018 |
| Molecular Formula | C30H37F2N3O2 |
| Molecular Weight | 509.64 g/mol |
| Exact Mass | 509.29 |
| IUPAC Name | (1R,3R)-1-[4-(1-butylazetidin-3-yl)oxy-2,6-difluorophenyl]-3-methyl-2-[(3-methyloxetan-3-yl)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CCCCN1CC(Oc2cc(F)c([C@@H]3c4[nH]c5ccccc5c4C[C@@H](C)N3CC3(C)COC3)c(F)c2)C1 |
| InChI | InChI=1S/C30H37F2N3O2/c1-4-5-10-34-14-21(15-34)37-20-12-24(31)27(25(32)13-20)29-28-23(22-8-6-7-9-26(22)33-28)11-19(2)35(29)16-30(3)17-36-18-30/h6-9,12-13,19,21,29,33H,4-5,10-11,14-18H2,1-3H3/t19-,29-/m1/s1 |
| InChIKey | SDVAVLARPDANDR-SONOPUAISA-N |
| XLogP | 5.68 |
| TPSA | 40.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.64 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|