C29H33F4N3O — CID 145418277
(1-butylazetidin-3-yl)-[4-[(1R,3R)-2-(2,3-difluoropropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]methanone (PubChem CID 145418277) has the molecular formula C29H33F4N3O and a molecular weight of 515.60 g/mol. Its IUPAC name is (1-butylazetidin-3-yl)-[4-[(1R,3R)-2-(2,3-difluoropropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]methanone.
| Compound Name | (1-butylazetidin-3-yl)-[4-[(1R,3R)-2-(2,3-difluoropropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]methanone |
|---|---|
| PubChem CID | 145418277 |
| Molecular Formula | C29H33F4N3O |
| Molecular Weight | 515.60 g/mol |
| Exact Mass | 515.26 |
| IUPAC Name | (1-butylazetidin-3-yl)-[4-[(1R,3R)-2-(2,3-difluoropropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]methanone |
| SMILES | CCCCN1CC(C(=O)c2cc(F)c([C@@H]3c4[nH]c5ccccc5c4C[C@@H](C)N3CC(F)CF)c(F)c2)C1 |
| InChI | InChI=1S/C29H33F4N3O/c1-3-4-9-35-14-19(15-35)29(37)18-11-23(32)26(24(33)12-18)28-27-22(21-7-5-6-8-25(21)34-27)10-17(2)36(28)16-20(31)13-30/h5-8,11-12,17,19-20,28,34H,3-4,9-10,13-16H2,1-2H3/t17-,20?,28-/m1/s1 |
| InChIKey | XRLCYLVRLVTQAG-QPADQPFZSA-N |
| XLogP | 6.00 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.60 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|