C21H20BrF3N2O — CID 153378718
3-[1-(4-bromo-2,6-difluorophenyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-fluoropropan-1-ol (PubChem CID 153378718) has the molecular formula C21H20BrF3N2O and a molecular weight of 453.30 g/mol. Its IUPAC name is 3-[1-(4-bromo-2,6-difluorophenyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-fluoropropan-1-ol.
| Compound Name | 3-[1-(4-bromo-2,6-difluorophenyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-fluoropropan-1-ol |
|---|---|
| PubChem CID | 153378718 |
| Molecular Formula | C21H20BrF3N2O |
| Molecular Weight | 453.30 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | 3-[1-(4-bromo-2,6-difluorophenyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-fluoropropan-1-ol |
| SMILES | CC1Cc2c([nH]c3ccccc23)C(c2c(F)cc(Br)cc2F)N1CC(F)CO |
| InChI | InChI=1S/C21H20BrF3N2O/c1-11-6-15-14-4-2-3-5-18(14)26-20(15)21(27(11)9-13(23)10-28)19-16(24)7-12(22)8-17(19)25/h2-5,7-8,11,13,21,26,28H,6,9-10H2,1H3 |
| InChIKey | PCHZZPOQUIOGIR-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.30 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|