C37H37BrF4N2OSi — CID 157046211
[3-[(1S,3R)-1-(4-bromo-2,6-difluorophenyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-difluoropropoxy]-tert-butyl-diphenylsilane (PubChem CID 157046211) has the molecular formula C37H37BrF4N2OSi and a molecular weight of 709.70 g/mol. Its IUPAC name is [3-[(1S,3R)-1-(4-bromo-2,6-difluorophenyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-difluoropropoxy]-tert-butyl-diphenylsilane.
| Compound Name | [3-[(1S,3R)-1-(4-bromo-2,6-difluorophenyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-difluoropropoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 157046211 |
| Molecular Formula | C37H37BrF4N2OSi |
| Molecular Weight | 709.70 g/mol |
| Exact Mass | 708.18 |
| IUPAC Name | [3-[(1S,3R)-1-(4-bromo-2,6-difluorophenyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-difluoropropoxy]-tert-butyl-diphenylsilane |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@H](c2c(F)cc(Br)cc2F)N1CC(F)(F)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C37H37BrF4N2OSi/c1-24-19-29-28-17-11-12-18-32(28)43-34(29)35(33-30(39)20-25(38)21-31(33)40)44(24)22-37(41,42)23-45-46(36(2,3)4,26-13-7-5-8-14-26)27-15-9-6-10-16-27/h5-18,20-21,24,35,43H,19,22-23H2,1-4H3/t24-,35+/m1/s1 |
| InChIKey | MQWGBIFLARQLKU-COOREUGTSA-N |
| XLogP | 8.76 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.70 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|