C45H52F4N4O3Si — CID 140830269
tert-butyl 3-[4-[2-[3-[tert-butyl(diphenyl)silyl]oxy-2,2-difluoropropyl]-3-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-1-yl]-3,5-difluoroanilino]azetidine-1-carboxylate (PubChem CID 140830269) has the molecular formula C45H52F4N4O3Si and a molecular weight of 801.01 g/mol. Its IUPAC name is tert-butyl 3-[4-[2-[3-[tert-butyl(diphenyl)silyl]oxy-2,2-difluoropropyl]-3-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-1-yl]-3,5-difluoroanilino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-[2-[3-[tert-butyl(diphenyl)silyl]oxy-2,2-difluoropropyl]-3-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-1-yl]-3,5-difluoroanilino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 140830269 |
| Molecular Formula | C45H52F4N4O3Si |
| Molecular Weight | 801.01 g/mol |
| Exact Mass | 800.37 |
| IUPAC Name | tert-butyl 3-[4-[2-[3-[tert-butyl(diphenyl)silyl]oxy-2,2-difluoropropyl]-3-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-1-yl]-3,5-difluoroanilino]azetidine-1-carboxylate |
| SMILES | CC1Cc2[nH]c3ccccc3c2C(c2c(F)cc(NC3CN(C(=O)OC(C)(C)C)C3)cc2F)N1CC(F)(F)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C45H52F4N4O3Si/c1-29-22-38-39(34-20-14-15-21-37(34)51-38)41(40-35(46)23-30(24-36(40)47)50-31-25-52(26-31)42(54)56-43(2,3)4)53(29)27-45(48,49)28-55-57(44(5,6)7,32-16-10-8-11-17-32)33-18-12-9-13-19-33/h8-21,23-24,29,31,41,50-51H,22,25-28H2,1-7H3 |
| InChIKey | IKYOUXWCQLVGOZ-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 69.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.01 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|