C39H45F3N4O3Si — CID 174106394
6-[(5S,7R)-6-[3-[tert-butyl(diphenyl)silyl]oxy-2,2-difluoropropyl]-7-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-5-fluoro-N-pyrrolidin-3-ylpyridin-3-amine (PubChem CID 174106394) has the molecular formula C39H45F3N4O3Si and a molecular weight of 702.89 g/mol. Its IUPAC name is 6-[(5S,7R)-6-[3-[tert-butyl(diphenyl)silyl]oxy-2,2-difluoropropyl]-7-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-5-fluoro-N-pyrrolidin-3-ylpyridin-3-amine.
| Compound Name | 6-[(5S,7R)-6-[3-[tert-butyl(diphenyl)silyl]oxy-2,2-difluoropropyl]-7-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-5-fluoro-N-pyrrolidin-3-ylpyridin-3-amine |
|---|---|
| PubChem CID | 174106394 |
| Molecular Formula | C39H45F3N4O3Si |
| Molecular Weight | 702.89 g/mol |
| Exact Mass | 702.32 |
| IUPAC Name | 6-[(5S,7R)-6-[3-[tert-butyl(diphenyl)silyl]oxy-2,2-difluoropropyl]-7-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-5-fluoro-N-pyrrolidin-3-ylpyridin-3-amine |
| SMILES | C[C@@H]1Cc2cc3c(cc2[C@@H](c2ncc(NC4CCNC4)cc2F)N1CC(F)(F)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OCO3 |
| InChI | InChI=1S/C39H45F3N4O3Si/c1-26-17-27-18-34-35(48-25-47-34)20-32(27)37(36-33(40)19-29(22-44-36)45-28-15-16-43-21-28)46(26)23-39(41,42)24-49-50(38(2,3)4,30-11-7-5-8-12-30)31-13-9-6-10-14-31/h5-14,18-20,22,26,28,37,43,45H,15-17,21,23-25H2,1-4H3/t26-,28?,37+/m1/s1 |
| InChIKey | WMKMOOLRBBWUEZ-AKTNCIPXSA-N |
| XLogP | 6.27 |
| TPSA | 67.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.89 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|