C36H40F2N4OSi — CID 142335589
tert-butyl-[2,2-difluoro-3-[(6S,8R)-8-methyl-6-(5-methyl-2-pyridinyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-7-yl]propoxy]-diphenylsilane (PubChem CID 142335589) has the molecular formula C36H40F2N4OSi and a molecular weight of 610.83 g/mol. Its IUPAC name is tert-butyl-[2,2-difluoro-3-[(6S,8R)-8-methyl-6-(5-methyl-2-pyridinyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-7-yl]propoxy]-diphenylsilane.
| Compound Name | tert-butyl-[2,2-difluoro-3-[(6S,8R)-8-methyl-6-(5-methyl-2-pyridinyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-7-yl]propoxy]-diphenylsilane |
|---|---|
| PubChem CID | 142335589 |
| Molecular Formula | C36H40F2N4OSi |
| Molecular Weight | 610.83 g/mol |
| Exact Mass | 610.29 |
| IUPAC Name | tert-butyl-[2,2-difluoro-3-[(6S,8R)-8-methyl-6-(5-methyl-2-pyridinyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-7-yl]propoxy]-diphenylsilane |
| SMILES | Cc1ccc([C@@H]2c3ccc4[nH]ncc4c3C[C@@H](C)N2CC(F)(F)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)nc1 |
| InChI | InChI=1S/C36H40F2N4OSi/c1-25-16-18-33(39-21-25)34-29-17-19-32-31(22-40-41-32)30(29)20-26(2)42(34)23-36(37,38)24-43-44(35(3,4)5,27-12-8-6-9-13-27)28-14-10-7-11-15-28/h6-19,21-22,26,34H,20,23-24H2,1-5H3,(H,40,41)/t26-,34+/m1/s1 |
| InChIKey | AXXZNPPBFCHWMD-SFRLIIPVSA-N |
| XLogP | 6.81 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.83 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|