C38H44F2N4OSSi — CID 170950876
[3-[(1S,3R)-1-[5-(azetidin-3-ylmethyl)-1,3-thiazol-2-yl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-difluoropropoxy]-tert-butyl-diphenylsilane (PubChem CID 170950876) has the molecular formula C38H44F2N4OSSi and a molecular weight of 670.95 g/mol. Its IUPAC name is [3-[(1S,3R)-1-[5-(azetidin-3-ylmethyl)-1,3-thiazol-2-yl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-difluoropropoxy]-tert-butyl-diphenylsilane.
| Compound Name | [3-[(1S,3R)-1-[5-(azetidin-3-ylmethyl)-1,3-thiazol-2-yl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-difluoropropoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 170950876 |
| Molecular Formula | C38H44F2N4OSSi |
| Molecular Weight | 670.95 g/mol |
| Exact Mass | 670.30 |
| IUPAC Name | [3-[(1S,3R)-1-[5-(azetidin-3-ylmethyl)-1,3-thiazol-2-yl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-difluoropropoxy]-tert-butyl-diphenylsilane |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2ncc(CC3CNC3)s2)N1CC(F)(F)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C38H44F2N4OSSi/c1-26-19-32-31-17-11-12-18-33(31)43-34(32)35(36-42-23-28(46-36)20-27-21-41-22-27)44(26)24-38(39,40)25-45-47(37(2,3)4,29-13-7-5-8-14-29)30-15-9-6-10-16-30/h5-18,23,26-27,35,41,43H,19-22,24-25H2,1-4H3/t26-,35+/m1/s1 |
| InChIKey | YSDTXBROICIVJE-IJAHGLKVSA-N |
| XLogP | 6.93 |
| TPSA | 53.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.95 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|