C24H30F2N4S — CID 170950940
2-[(1S,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-5-[(1-propylazetidin-3-yl)methyl]-1,3-thiazole (PubChem CID 170950940) has the molecular formula C24H30F2N4S and a molecular weight of 444.60 g/mol. Its IUPAC name is 2-[(1S,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-5-[(1-propylazetidin-3-yl)methyl]-1,3-thiazole.
| Compound Name | 2-[(1S,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-5-[(1-propylazetidin-3-yl)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 170950940 |
| Molecular Formula | C24H30F2N4S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 2-[(1S,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-5-[(1-propylazetidin-3-yl)methyl]-1,3-thiazole |
| SMILES | CCCN1CC(Cc2cnc([C@@H]3c4[nH]c5ccccc5c4C[C@@H](C)N3CC(F)F)s2)C1 |
| InChI | InChI=1S/C24H30F2N4S/c1-3-8-29-12-16(13-29)10-17-11-27-24(31-17)23-22-19(9-15(2)30(23)14-21(25)26)18-6-4-5-7-20(18)28-22/h4-7,11,15-16,21,23,28H,3,8-10,12-14H2,1-2H3/t15-,23+/m1/s1 |
| InChIKey | JIPGOGIAGHFHDC-CMJOXMDJSA-N |
| XLogP | 5.11 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|