C26H34F2N4S — CID 170950906
2-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-5-[[1-(3-fluoropropyl)azetidin-3-yl]methyl]-1,3-thiazole (PubChem CID 170950906) has the molecular formula C26H34F2N4S and a molecular weight of 472.65 g/mol. Its IUPAC name is 2-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-5-[[1-(3-fluoropropyl)azetidin-3-yl]methyl]-1,3-thiazole.
| Compound Name | 2-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-5-[[1-(3-fluoropropyl)azetidin-3-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 170950906 |
| Molecular Formula | C26H34F2N4S |
| Molecular Weight | 472.65 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | 2-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-5-[[1-(3-fluoropropyl)azetidin-3-yl]methyl]-1,3-thiazole |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2ncc(CC3CN(CCCF)C3)s2)N1CC(C)(C)F |
| InChI | InChI=1S/C26H34F2N4S/c1-17-11-21-20-7-4-5-8-22(20)30-23(21)24(32(17)16-26(2,3)28)25-29-13-19(33-25)12-18-14-31(15-18)10-6-9-27/h4-5,7-8,13,17-18,24,30H,6,9-12,14-16H2,1-3H3/t17-,24+/m1/s1 |
| InChIKey | UJZNZPMYTHRCFH-OSPHWJPCSA-N |
| XLogP | 5.54 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.65 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|