C24H28F4N4S — CID 170950914
5-[[1-(3-fluoropropyl)azetidin-3-yl]methyl]-2-[(1S,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-1,3-thiazole (PubChem CID 170950914) has the molecular formula C24H28F4N4S and a molecular weight of 480.58 g/mol. Its IUPAC name is 5-[[1-(3-fluoropropyl)azetidin-3-yl]methyl]-2-[(1S,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-1,3-thiazole.
| Compound Name | 5-[[1-(3-fluoropropyl)azetidin-3-yl]methyl]-2-[(1S,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 170950914 |
| Molecular Formula | C24H28F4N4S |
| Molecular Weight | 480.58 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 5-[[1-(3-fluoropropyl)azetidin-3-yl]methyl]-2-[(1S,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-1,3-thiazole |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2ncc(CC3CN(CCCF)C3)s2)N1CC(F)(F)F |
| InChI | InChI=1S/C24H28F4N4S/c1-15-9-19-18-5-2-3-6-20(18)30-21(19)22(32(15)14-24(26,27)28)23-29-11-17(33-23)10-16-12-31(13-16)8-4-7-25/h2-3,5-6,11,15-16,22,30H,4,7-10,12-14H2,1H3/t15-,22+/m1/s1 |
| InChIKey | RVXCKUHHZDPVBJ-QRQCRPRQSA-N |
| XLogP | 5.36 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.58 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|