C19H19F3N4 — CID 175845873
6-[(1S,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]pyridin-3-amine (PubChem CID 175845873) has the molecular formula C19H19F3N4 and a molecular weight of 360.38 g/mol. Its IUPAC name is 6-[(1S,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]pyridin-3-amine.
| Compound Name | 6-[(1S,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 175845873 |
| Molecular Formula | C19H19F3N4 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 6-[(1S,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]pyridin-3-amine |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2ccc(N)cn2)N1CC(F)(F)F |
| InChI | InChI=1S/C19H19F3N4/c1-11-8-14-13-4-2-3-5-15(13)25-17(14)18(26(11)10-19(20,21)22)16-7-6-12(23)9-24-16/h2-7,9,11,18,25H,8,10,23H2,1H3/t11-,18-/m1/s1 |
| InChIKey | PCJYGCKRXMRIIO-ADLMAVQZSA-N |
| XLogP | 4.04 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|