C23H28FN3 — CID 167601842
(1R,3R)-1-(6-ethyl-3-pyridinyl)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 167601842) has the molecular formula C23H28FN3 and a molecular weight of 365.50 g/mol. Its IUPAC name is (1R,3R)-1-(6-ethyl-3-pyridinyl)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1R,3R)-1-(6-ethyl-3-pyridinyl)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 167601842 |
| Molecular Formula | C23H28FN3 |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.23 |
| IUPAC Name | (1R,3R)-1-(6-ethyl-3-pyridinyl)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CCc1ccc([C@@H]2c3[nH]c4ccccc4c3C[C@@H](C)N2CC(C)(C)F)cn1 |
| InChI | InChI=1S/C23H28FN3/c1-5-17-11-10-16(13-25-17)22-21-19(18-8-6-7-9-20(18)26-21)12-15(2)27(22)14-23(3,4)24/h6-11,13,15,22,26H,5,12,14H2,1-4H3/t15-,22-/m1/s1 |
| InChIKey | JVRFZMWFVQYUAR-IVZQSRNASA-N |
| XLogP | 5.21 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|