C17H15BrF3N3S — CID 170950871
5-bromo-2-[(1S,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-1,3-thiazole (PubChem CID 170950871) has the molecular formula C17H15BrF3N3S and a molecular weight of 430.29 g/mol. Its IUPAC name is 5-bromo-2-[(1S,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-1,3-thiazole.
| Compound Name | 5-bromo-2-[(1S,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 170950871 |
| Molecular Formula | C17H15BrF3N3S |
| Molecular Weight | 430.29 g/mol |
| Exact Mass | 429.01 |
| IUPAC Name | 5-bromo-2-[(1S,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-1,3-thiazole |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2ncc(Br)s2)N1CC(F)(F)F |
| InChI | InChI=1S/C17H15BrF3N3S/c1-9-6-11-10-4-2-3-5-12(10)23-14(11)15(16-22-7-13(18)25-16)24(9)8-17(19,20)21/h2-5,7,9,15,23H,6,8H2,1H3/t9-,15+/m1/s1 |
| InChIKey | VDTIAFUFGOMGKY-PSLIRLAXSA-N |
| XLogP | 5.29 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.29 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|