C23H27F4N5O — CID 139346838
5-fluoro-5-[6-[(1S,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]pyrimidin-4-yl]oxypentan-1-amine (PubChem CID 139346838) has the molecular formula C23H27F4N5O and a molecular weight of 465.50 g/mol. Its IUPAC name is 5-fluoro-5-[6-[(1S,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]pyrimidin-4-yl]oxypentan-1-amine.
| Compound Name | 5-fluoro-5-[6-[(1S,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]pyrimidin-4-yl]oxypentan-1-amine |
|---|---|
| PubChem CID | 139346838 |
| Molecular Formula | C23H27F4N5O |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | 5-fluoro-5-[6-[(1S,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]pyrimidin-4-yl]oxypentan-1-amine |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2cc(OC(F)CCCCN)ncn2)N1CC(F)(F)F |
| InChI | InChI=1S/C23H27F4N5O/c1-14-10-16-15-6-2-3-7-17(15)31-21(16)22(32(14)12-23(25,26)27)18-11-20(30-13-29-18)33-19(24)8-4-5-9-28/h2-3,6-7,11,13-14,19,22,31H,4-5,8-10,12,28H2,1H3/t14-,19?,22-/m1/s1 |
| InChIKey | VSTFNZNKNAFEEF-LKMYZTPQSA-N |
| XLogP | 4.66 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|