C21H18BrF5N2O — CID 167202823
(1R,3R)-1-[4-bromo-2-(difluoromethoxy)phenyl]-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 167202823) has the molecular formula C21H18BrF5N2O and a molecular weight of 489.28 g/mol. Its IUPAC name is (1R,3R)-1-[4-bromo-2-(difluoromethoxy)phenyl]-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1R,3R)-1-[4-bromo-2-(difluoromethoxy)phenyl]-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 167202823 |
| Molecular Formula | C21H18BrF5N2O |
| Molecular Weight | 489.28 g/mol |
| Exact Mass | 488.05 |
| IUPAC Name | (1R,3R)-1-[4-bromo-2-(difluoromethoxy)phenyl]-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2ccc(Br)cc2OC(F)F)N1CC(F)(F)F |
| InChI | InChI=1S/C21H18BrF5N2O/c1-11-8-15-13-4-2-3-5-16(13)28-18(15)19(29(11)10-21(25,26)27)14-7-6-12(22)9-17(14)30-20(23)24/h2-7,9,11,19-20,28H,8,10H2,1H3/t11-,19-/m1/s1 |
| InChIKey | GAJQISQHYRUIJW-NSPYISDASA-N |
| XLogP | 6.43 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.28 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|