C24H25BrFN3 — CID 170950998
(1R,3R)-1-(6-bromo-1H-indol-3-yl)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 170950998) has the molecular formula C24H25BrFN3 and a molecular weight of 454.39 g/mol. Its IUPAC name is (1R,3R)-1-(6-bromo-1H-indol-3-yl)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1R,3R)-1-(6-bromo-1H-indol-3-yl)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 170950998 |
| Molecular Formula | C24H25BrFN3 |
| Molecular Weight | 454.39 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | (1R,3R)-1-(6-bromo-1H-indol-3-yl)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2c[nH]c3cc(Br)ccc23)N1CC(C)(C)F |
| InChI | InChI=1S/C24H25BrFN3/c1-14-10-18-16-6-4-5-7-20(16)28-22(18)23(29(14)13-24(2,3)26)19-12-27-21-11-15(25)8-9-17(19)21/h4-9,11-12,14,23,27-28H,10,13H2,1-3H3/t14-,23-/m1/s1 |
| InChIKey | LXYJPPLNHMJFBS-QKFKETGDSA-N |
| XLogP | 6.50 |
| TPSA | 34.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.39 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|