C30H40FN3O — CID 160584337
(1R,3R)-1-[4-[2-[(3R)-3-ethylpyrrolidin-1-yl]ethoxy]phenyl]-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 160584337) has the molecular formula C30H40FN3O and a molecular weight of 477.67 g/mol. Its IUPAC name is (1R,3R)-1-[4-[2-[(3R)-3-ethylpyrrolidin-1-yl]ethoxy]phenyl]-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1R,3R)-1-[4-[2-[(3R)-3-ethylpyrrolidin-1-yl]ethoxy]phenyl]-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 160584337 |
| Molecular Formula | C30H40FN3O |
| Molecular Weight | 477.67 g/mol |
| Exact Mass | 477.32 |
| IUPAC Name | (1R,3R)-1-[4-[2-[(3R)-3-ethylpyrrolidin-1-yl]ethoxy]phenyl]-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CC[C@@H]1CCN(CCOc2ccc([C@@H]3c4[nH]c5ccccc5c4C[C@@H](C)N3CC(C)(C)F)cc2)C1 |
| InChI | InChI=1S/C30H40FN3O/c1-5-22-14-15-33(19-22)16-17-35-24-12-10-23(11-13-24)29-28-26(25-8-6-7-9-27(25)32-28)18-21(2)34(29)20-30(3,4)31/h6-13,21-22,29,32H,5,14-20H2,1-4H3/t21-,22-,29-/m1/s1 |
| InChIKey | JUCZIELXJBWEGQ-IEOSBIPESA-N |
| XLogP | 6.36 |
| TPSA | 31.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.67 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|