C28H37F2N3O — CID 155475489
(1R,3R)-1-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]cyclohexa-1,3-dien-1-yl]-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 155475489) has the molecular formula C28H37F2N3O and a molecular weight of 469.62 g/mol. Its IUPAC name is (1R,3R)-1-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]cyclohexa-1,3-dien-1-yl]-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1R,3R)-1-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]cyclohexa-1,3-dien-1-yl]-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 155475489 |
| Molecular Formula | C28H37F2N3O |
| Molecular Weight | 469.62 g/mol |
| Exact Mass | 469.29 |
| IUPAC Name | (1R,3R)-1-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]cyclohexa-1,3-dien-1-yl]-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](C2=CC=C(OCCN3CC(CF)C3)CC2)N1CC(C)(C)F |
| InChI | InChI=1S/C28H37F2N3O/c1-19-14-24-23-6-4-5-7-25(23)31-26(24)27(33(19)18-28(2,3)30)21-8-10-22(11-9-21)34-13-12-32-16-20(15-29)17-32/h4-8,10,19-20,27,31H,9,11-18H2,1-3H3/t19-,27-/m1/s1 |
| InChIKey | WXYKDSAFDMMUKH-XHCCPWGMSA-N |
| XLogP | 5.73 |
| TPSA | 31.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.62 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|