C29H38FN3O2 — CID 159805377
(2R)-3-[(1R,3R)-1-[4-[2-(3-ethylazetidin-1-yl)ethoxy]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-fluoro-2-methylpropan-1-ol (PubChem CID 159805377) has the molecular formula C29H38FN3O2 and a molecular weight of 479.64 g/mol. Its IUPAC name is (2R)-3-[(1R,3R)-1-[4-[2-(3-ethylazetidin-1-yl)ethoxy]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-fluoro-2-methylpropan-1-ol.
| Compound Name | (2R)-3-[(1R,3R)-1-[4-[2-(3-ethylazetidin-1-yl)ethoxy]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-fluoro-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 159805377 |
| Molecular Formula | C29H38FN3O2 |
| Molecular Weight | 479.64 g/mol |
| Exact Mass | 479.29 |
| IUPAC Name | (2R)-3-[(1R,3R)-1-[4-[2-(3-ethylazetidin-1-yl)ethoxy]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-fluoro-2-methylpropan-1-ol |
| SMILES | CCC1CN(CCOc2ccc([C@@H]3c4[nH]c5ccccc5c4C[C@@H](C)N3C[C@@](C)(F)CO)cc2)C1 |
| InChI | InChI=1S/C29H38FN3O2/c1-4-21-16-32(17-21)13-14-35-23-11-9-22(10-12-23)28-27-25(24-7-5-6-8-26(24)31-27)15-20(2)33(28)18-29(3,30)19-34/h5-12,20-21,28,31,34H,4,13-19H2,1-3H3/t20-,28-,29-/m1/s1 |
| InChIKey | FOPFHZFEINAIIV-LMNMAEAPSA-N |
| XLogP | 4.95 |
| TPSA | 51.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.64 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|