C32H43FN6O — CID 171785522
trans-(1S,2S)-2-[[4-[5-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]pyrimidin-2-yl]piperazin-1-yl]methyl]cyclohexane-1-carbaldehyde (PubChem CID 171785522) has the molecular formula C32H43FN6O and a molecular weight of 546.74 g/mol. Its IUPAC name is trans-(1S,2S)-2-[[4-[5-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]pyrimidin-2-yl]piperazin-1-yl]methyl]cyclohexane-1-carbaldehyde.
| Compound Name | trans-(1S,2S)-2-[[4-[5-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]pyrimidin-2-yl]piperazin-1-yl]methyl]cyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 171785522 |
| Molecular Formula | C32H43FN6O |
| Molecular Weight | 546.74 g/mol |
| Exact Mass | 546.35 |
| IUPAC Name | trans-(1S,2S)-2-[[4-[5-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]pyrimidin-2-yl]piperazin-1-yl]methyl]cyclohexane-1-carbaldehyde |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2cnc(N3CCN(C[C@H]4CCCC[C@@H]4C=O)CC3)nc2)N1CC(C)(C)F |
| InChI | InChI=1S/C32H43FN6O/c1-22-16-27-26-10-6-7-11-28(26)36-29(27)30(39(22)21-32(2,3)33)25-17-34-31(35-18-25)38-14-12-37(13-15-38)19-23-8-4-5-9-24(23)20-40/h6-7,10-11,17-18,20,22-24,30,36H,4-5,8-9,12-16,19,21H2,1-3H3/t22-,23-,24-,30-/m1/s1 |
| InChIKey | BCEDFKXIDREQBO-NULUGNBJSA-N |
| XLogP | 5.17 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.74 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|