C26H33F3N5P — CID 170365495
6-[(1S,3R)-2-(2,2-difluoro-2-phosphanylethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-N-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]pyridin-3-amine (PubChem CID 170365495) has the molecular formula C26H33F3N5P and a molecular weight of 503.55 g/mol. Its IUPAC name is 6-[(1S,3R)-2-(2,2-difluoro-2-phosphanylethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-N-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]pyridin-3-amine.
| Compound Name | 6-[(1S,3R)-2-(2,2-difluoro-2-phosphanylethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-N-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 170365495 |
| Molecular Formula | C26H33F3N5P |
| Molecular Weight | 503.55 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | 6-[(1S,3R)-2-(2,2-difluoro-2-phosphanylethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-N-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]pyridin-3-amine |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2ccc(N[C@H]3CCN(CCCF)C3)cn2)N1CC(F)(F)P |
| InChI | InChI=1S/C26H33F3N5P/c1-17-13-21-20-5-2-3-6-22(20)32-24(21)25(34(17)16-26(28,29)35)23-8-7-18(14-30-23)31-19-9-12-33(15-19)11-4-10-27/h2-3,5-8,14,17,19,25,31-32H,4,9-13,15-16,35H2,1H3/t17-,19+,25-/m1/s1 |
| InChIKey | MALOXFDKXJSEEJ-VDABOFBKSA-N |
| XLogP | 5.21 |
| TPSA | 47.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.55 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|