C27H31F4N5 — CID 174351392
N-[1-(3-fluoropropyl)azetidin-3-yl]-6-[(6S)-4-methyl-5-(2,2,2-trifluoroethyl)-5,8-diazatetracyclo[7.6.0.02,7.011,14]pentadeca-1(9),2(7),10,14-tetraen-6-yl]pyridin-3-amine (PubChem CID 174351392) has the molecular formula C27H31F4N5 and a molecular weight of 501.57 g/mol. Its IUPAC name is N-[1-(3-fluoropropyl)azetidin-3-yl]-6-[(6S)-4-methyl-5-(2,2,2-trifluoroethyl)-5,8-diazatetracyclo[7.6.0.02,7.011,14]pentadeca-1(9),2(7),10,14-tetraen-6-yl]pyridin-3-amine.
| Compound Name | N-[1-(3-fluoropropyl)azetidin-3-yl]-6-[(6S)-4-methyl-5-(2,2,2-trifluoroethyl)-5,8-diazatetracyclo[7.6.0.02,7.011,14]pentadeca-1(9),2(7),10,14-tetraen-6-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 174351392 |
| Molecular Formula | C27H31F4N5 |
| Molecular Weight | 501.57 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | N-[1-(3-fluoropropyl)azetidin-3-yl]-6-[(6S)-4-methyl-5-(2,2,2-trifluoroethyl)-5,8-diazatetracyclo[7.6.0.02,7.011,14]pentadeca-1(9),2(7),10,14-tetraen-6-yl]pyridin-3-amine |
| SMILES | CC1Cc2c([nH]c3cc4c(cc23)CC4)[C@@H](c2ccc(NC3CN(CCCF)C3)cn2)N1CC(F)(F)F |
| InChI | InChI=1S/C27H31F4N5/c1-16-9-22-21-10-17-3-4-18(17)11-24(21)34-25(22)26(36(16)15-27(29,30)31)23-6-5-19(12-32-23)33-20-13-35(14-20)8-2-7-28/h5-6,10-12,16,20,26,33-34H,2-4,7-9,13-15H2,1H3/t16?,26-/m1/s1 |
| InChIKey | VXJHUQQAXLADGA-IIVOFZELSA-N |
| XLogP | 5.02 |
| TPSA | 47.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.57 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|