C26H30F4N6 — CID 146265503
N-[1-(3-fluoropropyl)azetidin-3-yl]-6-[(1R,3R)-3-methyl-6-pyrazol-1-yl-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinolin-1-yl]pyridin-3-amine (PubChem CID 146265503) has the molecular formula C26H30F4N6 and a molecular weight of 502.56 g/mol. Its IUPAC name is N-[1-(3-fluoropropyl)azetidin-3-yl]-6-[(1R,3R)-3-methyl-6-pyrazol-1-yl-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinolin-1-yl]pyridin-3-amine.
| Compound Name | N-[1-(3-fluoropropyl)azetidin-3-yl]-6-[(1R,3R)-3-methyl-6-pyrazol-1-yl-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinolin-1-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 146265503 |
| Molecular Formula | C26H30F4N6 |
| Molecular Weight | 502.56 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | N-[1-(3-fluoropropyl)azetidin-3-yl]-6-[(1R,3R)-3-methyl-6-pyrazol-1-yl-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinolin-1-yl]pyridin-3-amine |
| SMILES | C[C@@H]1Cc2cc(-n3cccn3)ccc2[C@H](c2ccc(NC3CN(CCCF)C3)cn2)N1CC(F)(F)F |
| InChI | InChI=1S/C26H30F4N6/c1-18-12-19-13-22(36-11-3-9-32-36)5-6-23(19)25(35(18)17-26(28,29)30)24-7-4-20(14-31-24)33-21-15-34(16-21)10-2-8-27/h3-7,9,11,13-14,18,21,25,33H,2,8,10,12,15-17H2,1H3/t18-,25-/m1/s1 |
| InChIKey | UZNXOKIUHRBBIY-IQGLISFBSA-N |
| XLogP | 4.62 |
| TPSA | 49.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.56 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |