C26H30F4N6 — CID 146265491
N-[1-(3-fluoropropyl)azetidin-3-yl]-6-[(1R,3R)-3-methyl-6-(1H-pyrazol-4-yl)-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinolin-1-yl]pyridin-3-amine (PubChem CID 146265491) has the molecular formula C26H30F4N6 and a molecular weight of 502.56 g/mol. Its IUPAC name is N-[1-(3-fluoropropyl)azetidin-3-yl]-6-[(1R,3R)-3-methyl-6-(1H-pyrazol-4-yl)-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinolin-1-yl]pyridin-3-amine.
| Compound Name | N-[1-(3-fluoropropyl)azetidin-3-yl]-6-[(1R,3R)-3-methyl-6-(1H-pyrazol-4-yl)-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinolin-1-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 146265491 |
| Molecular Formula | C26H30F4N6 |
| Molecular Weight | 502.56 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | N-[1-(3-fluoropropyl)azetidin-3-yl]-6-[(1R,3R)-3-methyl-6-(1H-pyrazol-4-yl)-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinolin-1-yl]pyridin-3-amine |
| SMILES | C[C@@H]1Cc2cc(-c3cn[nH]c3)ccc2[C@H](c2ccc(NC3CN(CCCF)C3)cn2)N1CC(F)(F)F |
| InChI | InChI=1S/C26H30F4N6/c1-17-9-19-10-18(20-11-32-33-12-20)3-5-23(19)25(36(17)16-26(28,29)30)24-6-4-21(13-31-24)34-22-14-35(15-22)8-2-7-27/h3-6,10-13,17,22,25,34H,2,7-9,14-16H2,1H3,(H,32,33)/t17-,25-/m1/s1 |
| InChIKey | BJDIFDUOVGGGIY-CRICUBBOSA-N |
| XLogP | 4.83 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.56 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |