C24H27F5N6 — CID 162647586
6-[(6S,8R)-5-fluoro-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,3-f]isoquinolin-6-yl]-N-[1-(3-fluoropropyl)azetidin-3-yl]pyridin-3-amine (PubChem CID 162647586) has the molecular formula C24H27F5N6 and a molecular weight of 494.51 g/mol. Its IUPAC name is 6-[(6S,8R)-5-fluoro-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,3-f]isoquinolin-6-yl]-N-[1-(3-fluoropropyl)azetidin-3-yl]pyridin-3-amine.
| Compound Name | 6-[(6S,8R)-5-fluoro-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,3-f]isoquinolin-6-yl]-N-[1-(3-fluoropropyl)azetidin-3-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 162647586 |
| Molecular Formula | C24H27F5N6 |
| Molecular Weight | 494.51 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | 6-[(6S,8R)-5-fluoro-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,3-f]isoquinolin-6-yl]-N-[1-(3-fluoropropyl)azetidin-3-yl]pyridin-3-amine |
| SMILES | C[C@@H]1Cc2c(c(F)cc3[nH]ncc23)[C@@H](c2ccc(NC3CN(CCCF)C3)cn2)N1CC(F)(F)F |
| InChI | InChI=1S/C24H27F5N6/c1-14-7-17-18-10-31-33-21(18)8-19(26)22(17)23(35(14)13-24(27,28)29)20-4-3-15(9-30-20)32-16-11-34(12-16)6-2-5-25/h3-4,8-10,14,16,23,32H,2,5-7,11-13H2,1H3,(H,31,33)/t14-,23-/m1/s1 |
| InChIKey | BKVJTTDWHITPNL-QKFKETGDSA-N |
| XLogP | 4.45 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.51 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |