C27H33F4N5 — CID 166473173
6-[(1S,3R)-3,6-dimethyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-N-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]pyridin-3-amine (PubChem CID 166473173) has the molecular formula C27H33F4N5 and a molecular weight of 503.59 g/mol. Its IUPAC name is 6-[(1S,3R)-3,6-dimethyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-N-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]pyridin-3-amine.
| Compound Name | 6-[(1S,3R)-3,6-dimethyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-N-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 166473173 |
| Molecular Formula | C27H33F4N5 |
| Molecular Weight | 503.59 g/mol |
| Exact Mass | 503.27 |
| IUPAC Name | 6-[(1S,3R)-3,6-dimethyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-N-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]pyridin-3-amine |
| SMILES | Cc1ccc2[nH]c3c(c2c1)C[C@@H](C)N(CC(F)(F)F)[C@@H]3c1ccc(N[C@H]2CCN(CCCF)C2)cn1 |
| InChI | InChI=1S/C27H33F4N5/c1-17-4-6-23-21(12-17)22-13-18(2)36(16-27(29,30)31)26(25(22)34-23)24-7-5-19(14-32-24)33-20-8-11-35(15-20)10-3-9-28/h4-7,12,14,18,20,26,33-34H,3,8-11,13,15-16H2,1-2H3/t18-,20+,26-/m1/s1 |
| InChIKey | WBZSATGNMKMWFO-ZTEVPRNISA-N |
| XLogP | 5.62 |
| TPSA | 47.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.59 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|