C25H29F4N5 — CID 134458798
1-(3-fluoropropyl)-N-[4-[(6R,8R)-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]phenyl]azetidin-3-amine (PubChem CID 134458798) has the molecular formula C25H29F4N5 and a molecular weight of 475.53 g/mol. Its IUPAC name is 1-(3-fluoropropyl)-N-[4-[(6R,8R)-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]phenyl]azetidin-3-amine.
| Compound Name | 1-(3-fluoropropyl)-N-[4-[(6R,8R)-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]phenyl]azetidin-3-amine |
|---|---|
| PubChem CID | 134458798 |
| Molecular Formula | C25H29F4N5 |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | 1-(3-fluoropropyl)-N-[4-[(6R,8R)-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]phenyl]azetidin-3-amine |
| SMILES | C[C@@H]1Cc2c(ccc3[nH]ncc23)[C@@H](c2ccc(NC3CN(CCCF)C3)cc2)N1CC(F)(F)F |
| InChI | InChI=1S/C25H29F4N5/c1-16-11-21-20(7-8-23-22(21)12-30-32-23)24(34(16)15-25(27,28)29)17-3-5-18(6-4-17)31-19-13-33(14-19)10-2-9-26/h3-8,12,16,19,24,31H,2,9-11,13-15H2,1H3,(H,30,32)/t16-,24-/m1/s1 |
| InChIKey | RDIWNJDCZLGDOS-VOIUYBSRSA-N |
| XLogP | 4.92 |
| TPSA | 47.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |