C29H34F5N5 — CID 175042907
(3S)-N-[4-[(1S,3R)-2-(2,2-difluoropropyl)-3-methyl-6-(1H-pyrazol-4-yl)-3,4-dihydro-1H-isoquinolin-1-yl]-3,5-difluorophenyl]-1-(3-fluoropropyl)pyrrolidin-3-amine (PubChem CID 175042907) has the molecular formula C29H34F5N5 and a molecular weight of 547.62 g/mol. Its IUPAC name is (3S)-N-[4-[(1S,3R)-2-(2,2-difluoropropyl)-3-methyl-6-(1H-pyrazol-4-yl)-3,4-dihydro-1H-isoquinolin-1-yl]-3,5-difluorophenyl]-1-(3-fluoropropyl)pyrrolidin-3-amine.
| Compound Name | (3S)-N-[4-[(1S,3R)-2-(2,2-difluoropropyl)-3-methyl-6-(1H-pyrazol-4-yl)-3,4-dihydro-1H-isoquinolin-1-yl]-3,5-difluorophenyl]-1-(3-fluoropropyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 175042907 |
| Molecular Formula | C29H34F5N5 |
| Molecular Weight | 547.62 g/mol |
| Exact Mass | 547.27 |
| IUPAC Name | (3S)-N-[4-[(1S,3R)-2-(2,2-difluoropropyl)-3-methyl-6-(1H-pyrazol-4-yl)-3,4-dihydro-1H-isoquinolin-1-yl]-3,5-difluorophenyl]-1-(3-fluoropropyl)pyrrolidin-3-amine |
| SMILES | C[C@@H]1Cc2cc(-c3cn[nH]c3)ccc2[C@@H](c2c(F)cc(N[C@H]3CCN(CCCF)C3)cc2F)N1CC(C)(F)F |
| InChI | InChI=1S/C29H34F5N5/c1-18-10-20-11-19(21-14-35-36-15-21)4-5-24(20)28(39(18)17-29(2,33)34)27-25(31)12-23(13-26(27)32)37-22-6-9-38(16-22)8-3-7-30/h4-5,11-15,18,22,28,37H,3,6-10,16-17H2,1-2H3,(H,35,36)/t18-,22+,28+/m1/s1 |
| InChIKey | CIVCPOQCEKVKTA-LXTALYMZSA-N |
| XLogP | 6.19 |
| TPSA | 47.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.62 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |