C23H26F5N7 — CID 139374276
5-[(8R)-1-fluoro-8-methyl-7-(2,2,2-trifluoroethyl)-2,6,8,9-tetrahydropyrazolo[4,3-f]isoquinolin-6-yl]-N-[1-(3-fluoropropyl)azetidin-3-yl]pyrazin-2-amine (PubChem CID 139374276) has the molecular formula C23H26F5N7 and a molecular weight of 495.50 g/mol. Its IUPAC name is 5-[(8R)-1-fluoro-8-methyl-7-(2,2,2-trifluoroethyl)-2,6,8,9-tetrahydropyrazolo[4,3-f]isoquinolin-6-yl]-N-[1-(3-fluoropropyl)azetidin-3-yl]pyrazin-2-amine.
| Compound Name | 5-[(8R)-1-fluoro-8-methyl-7-(2,2,2-trifluoroethyl)-2,6,8,9-tetrahydropyrazolo[4,3-f]isoquinolin-6-yl]-N-[1-(3-fluoropropyl)azetidin-3-yl]pyrazin-2-amine |
|---|---|
| PubChem CID | 139374276 |
| Molecular Formula | C23H26F5N7 |
| Molecular Weight | 495.50 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | 5-[(8R)-1-fluoro-8-methyl-7-(2,2,2-trifluoroethyl)-2,6,8,9-tetrahydropyrazolo[4,3-f]isoquinolin-6-yl]-N-[1-(3-fluoropropyl)azetidin-3-yl]pyrazin-2-amine |
| SMILES | C[C@@H]1Cc2c(ccc3n[nH]c(F)c23)C(c2cnc(NC3CN(CCCF)C3)cn2)N1CC(F)(F)F |
| InChI | InChI=1S/C23H26F5N7/c1-13-7-16-15(3-4-17-20(16)22(25)33-32-17)21(35(13)12-23(26,27)28)18-8-30-19(9-29-18)31-14-10-34(11-14)6-2-5-24/h3-4,8-9,13-14,21H,2,5-7,10-12H2,1H3,(H,30,31)(H,32,33)/t13-,21?/m1/s1 |
| InChIKey | ZMANQSXBZZYBCV-ILRUXTBWSA-N |
| XLogP | 3.85 |
| TPSA | 72.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |