C25H27F5N6 — CID 166931001
N-[1-(3-fluoropropyl)pyrrolidin-3-yl]-5-[1-fluoro-7-(2,2,2-trifluoroethyl)-2,8,9,10-tetrahydrocyclohepta[e]indazol-6-yl]pyrazin-2-amine (PubChem CID 166931001) has the molecular formula C25H27F5N6 and a molecular weight of 506.52 g/mol. Its IUPAC name is N-[1-(3-fluoropropyl)pyrrolidin-3-yl]-5-[1-fluoro-7-(2,2,2-trifluoroethyl)-2,8,9,10-tetrahydrocyclohepta[e]indazol-6-yl]pyrazin-2-amine.
| Compound Name | N-[1-(3-fluoropropyl)pyrrolidin-3-yl]-5-[1-fluoro-7-(2,2,2-trifluoroethyl)-2,8,9,10-tetrahydrocyclohepta[e]indazol-6-yl]pyrazin-2-amine |
|---|---|
| PubChem CID | 166931001 |
| Molecular Formula | C25H27F5N6 |
| Molecular Weight | 506.52 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | N-[1-(3-fluoropropyl)pyrrolidin-3-yl]-5-[1-fluoro-7-(2,2,2-trifluoroethyl)-2,8,9,10-tetrahydrocyclohepta[e]indazol-6-yl]pyrazin-2-amine |
| SMILES | FCCCN1CCC(Nc2cnc(C3=C(CC(F)(F)F)CCCc4c3ccc3n[nH]c(F)c43)cn2)C1 |
| InChI | InChI=1S/C25H27F5N6/c26-8-2-9-36-10-7-16(14-36)33-21-13-31-20(12-32-21)22-15(11-25(28,29)30)3-1-4-17-18(22)5-6-19-23(17)24(27)35-34-19/h5-6,12-13,16H,1-4,7-11,14H2,(H,32,33)(H,34,35) |
| InChIKey | CYWOABAOJWMOCT-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.52 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |