C22H25F4N7 — CID 146518517
N-[1-(3-fluoropropyl)azetidin-3-yl]-5-[(6S)-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]pyrazin-2-amine (PubChem CID 146518517) has the molecular formula C22H25F4N7 and a molecular weight of 463.48 g/mol. Its IUPAC name is N-[1-(3-fluoropropyl)azetidin-3-yl]-5-[(6S)-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]pyrazin-2-amine.
| Compound Name | N-[1-(3-fluoropropyl)azetidin-3-yl]-5-[(6S)-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]pyrazin-2-amine |
|---|---|
| PubChem CID | 146518517 |
| Molecular Formula | C22H25F4N7 |
| Molecular Weight | 463.48 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | N-[1-(3-fluoropropyl)azetidin-3-yl]-5-[(6S)-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]pyrazin-2-amine |
| SMILES | FCCCN1CC(Nc2cnc([C@@H]3c4ccc5[nH]ncc5c4CCN3CC(F)(F)F)cn2)C1 |
| InChI | InChI=1S/C22H25F4N7/c23-5-1-6-32-11-14(12-32)30-20-10-27-19(9-28-20)21-16-2-3-18-17(8-29-31-18)15(16)4-7-33(21)13-22(24,25)26/h2-3,8-10,14,21H,1,4-7,11-13H2,(H,28,30)(H,29,31)/t21-/m0/s1 |
| InChIKey | LLBFWUVWXFXMTF-NRFANRHFSA-N |
| XLogP | 3.32 |
| TPSA | 72.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.48 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |