C22H24F4N6 — CID 137372170
6-[(6S,8R)-1-fluoro-8-methyl-7-(2,2,2-trifluoroethyl)-2,6,8,9-tetrahydropyrazolo[4,3-f]isoquinolin-6-yl]-N-[(3S)-pyrrolidin-3-yl]pyridin-3-amine (PubChem CID 137372170) has the molecular formula C22H24F4N6 and a molecular weight of 448.47 g/mol. Its IUPAC name is 6-[(6S,8R)-1-fluoro-8-methyl-7-(2,2,2-trifluoroethyl)-2,6,8,9-tetrahydropyrazolo[4,3-f]isoquinolin-6-yl]-N-[(3S)-pyrrolidin-3-yl]pyridin-3-amine.
| Compound Name | 6-[(6S,8R)-1-fluoro-8-methyl-7-(2,2,2-trifluoroethyl)-2,6,8,9-tetrahydropyrazolo[4,3-f]isoquinolin-6-yl]-N-[(3S)-pyrrolidin-3-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 137372170 |
| Molecular Formula | C22H24F4N6 |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 6-[(6S,8R)-1-fluoro-8-methyl-7-(2,2,2-trifluoroethyl)-2,6,8,9-tetrahydropyrazolo[4,3-f]isoquinolin-6-yl]-N-[(3S)-pyrrolidin-3-yl]pyridin-3-amine |
| SMILES | C[C@@H]1Cc2c(ccc3n[nH]c(F)c23)[C@@H](c2ccc(N[C@H]3CCNC3)cn2)N1CC(F)(F)F |
| InChI | InChI=1S/C22H24F4N6/c1-12-8-16-15(3-5-17-19(16)21(23)31-30-17)20(32(12)11-22(24,25)26)18-4-2-13(10-28-18)29-14-6-7-27-9-14/h2-5,10,12,14,20,27,29H,6-9,11H2,1H3,(H,30,31)/t12-,14+,20+/m1/s1 |
| InChIKey | YCGWVXUZFKRXOB-VQZRKKFQSA-N |
| XLogP | 3.77 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |