C27H36FN3S — CID 170950830
(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1-[5-[3-(3-methylazetidin-1-yl)propyl]thiophen-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 170950830) has the molecular formula C27H36FN3S and a molecular weight of 453.67 g/mol. Its IUPAC name is (1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1-[5-[3-(3-methylazetidin-1-yl)propyl]thiophen-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1-[5-[3-(3-methylazetidin-1-yl)propyl]thiophen-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 170950830 |
| Molecular Formula | C27H36FN3S |
| Molecular Weight | 453.67 g/mol |
| Exact Mass | 453.26 |
| IUPAC Name | (1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1-[5-[3-(3-methylazetidin-1-yl)propyl]thiophen-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CC1CN(CCCc2ccc([C@@H]3c4[nH]c5ccccc5c4C[C@@H](C)N3CC(C)(C)F)s2)C1 |
| InChI | InChI=1S/C27H36FN3S/c1-18-15-30(16-18)13-7-8-20-11-12-24(32-20)26-25-22(21-9-5-6-10-23(21)29-25)14-19(2)31(26)17-27(3,4)28/h5-6,9-12,18-19,26,29H,7-8,13-17H2,1-4H3/t19-,26-/m1/s1 |
| InChIKey | UGAJJDRANBMAQG-NIYFSFCBSA-N |
| XLogP | 6.20 |
| TPSA | 22.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.67 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|