C28H36FN3O2S2 — CID 170950960
tert-butyl 3-[5-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]thiophen-2-yl]sulfanylazetidine-1-carboxylate (PubChem CID 170950960) has the molecular formula C28H36FN3O2S2 and a molecular weight of 529.75 g/mol. Its IUPAC name is tert-butyl 3-[5-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]thiophen-2-yl]sulfanylazetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[5-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]thiophen-2-yl]sulfanylazetidine-1-carboxylate |
|---|---|
| PubChem CID | 170950960 |
| Molecular Formula | C28H36FN3O2S2 |
| Molecular Weight | 529.75 g/mol |
| Exact Mass | 529.22 |
| IUPAC Name | tert-butyl 3-[5-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]thiophen-2-yl]sulfanylazetidine-1-carboxylate |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2ccc(SC3CN(C(=O)OC(C)(C)C)C3)s2)N1CC(C)(C)F |
| InChI | InChI=1S/C28H36FN3O2S2/c1-17-13-20-19-9-7-8-10-21(19)30-24(20)25(32(17)16-28(5,6)29)22-11-12-23(36-22)35-18-14-31(15-18)26(33)34-27(2,3)4/h7-12,17-18,25,30H,13-16H2,1-6H3/t17-,25-/m1/s1 |
| InChIKey | LQJXVHRIEZMZJY-CRICUBBOSA-N |
| XLogP | 7.02 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.75 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|