C17H22N2O2S — CID 135034855
tert-butyl 3-[(2-methyl-1H-indol-3-yl)sulfanyl]azetidine-1-carboxylate (PubChem CID 135034855) has the molecular formula C17H22N2O2S and a molecular weight of 318.44 g/mol. Its IUPAC name is tert-butyl 3-[(2-methyl-1H-indol-3-yl)sulfanyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(2-methyl-1H-indol-3-yl)sulfanyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 135034855 |
| Molecular Formula | C17H22N2O2S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | tert-butyl 3-[(2-methyl-1H-indol-3-yl)sulfanyl]azetidine-1-carboxylate |
| SMILES | Cc1[nH]c2ccccc2c1SC1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C17H22N2O2S/c1-11-15(13-7-5-6-8-14(13)18-11)22-12-9-19(10-12)16(20)21-17(2,3)4/h5-8,12,18H,9-10H2,1-4H3 |
| InChIKey | LLEJZIUJTZRTMK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |